CAS 1263365-85-0
:1-Cycloheptyl-2-(1,3-dioxolan-2-yl)ethanone
Description:
1-Cycloheptyl-2-(1,3-dioxolan-2-yl)ethanone is an organic compound characterized by its unique structure, which includes a cycloheptyl group and a dioxolane ring. The presence of the cycloheptyl moiety contributes to its cyclic and potentially rigid structure, influencing its physical and chemical properties. The dioxolane ring, a five-membered cyclic ether, adds to the compound's reactivity and solubility characteristics, often enhancing its stability and interaction with other chemical species. This compound is likely to exhibit moderate polarity due to the presence of both hydrophobic cycloheptyl and hydrophilic dioxolane components. Its ketone functional group (ethanone) suggests potential reactivity in nucleophilic addition reactions, making it a candidate for various synthetic applications in organic chemistry. Additionally, the compound's unique structure may impart specific biological activities, although detailed studies would be necessary to elucidate its potential pharmacological properties. Overall, 1-Cycloheptyl-2-(1,3-dioxolan-2-yl)ethanone represents a fascinating subject for further research in both synthetic and medicinal chemistry.
Formula:C12H20O3
InChI:InChI=1S/C12H20O3/c13-11(9-12-14-7-8-15-12)10-5-3-1-2-4-6-10/h10,12H,1-9H2
InChI key:InChIKey=KOTFJEAHUSZHFJ-UHFFFAOYSA-N
SMILES:C(CC1OCCO1)(=O)C2CCCCCC2
Synonyms:- Ethanone, 1-cycloheptyl-2-(1,3-dioxolan-2-yl)-
- 1-Cycloheptyl-2-(1,3-dioxolan-2-yl)ethanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.