CAS 1263365-86-1

4-Cyclohexyl-1-(1,3-dioxolan-2-yl)-2-butanone

Description:

4-Cyclohexyl-1-(1,3-dioxolan-2-yl)-2-butanone is an organic compound characterized by its unique structure, which includes a cyclohexyl group and a dioxolane ring. This compound features a ketone functional group, which contributes to its reactivity and potential applications in organic synthesis. The presence of the dioxolane moiety suggests that it may exhibit properties such as increased stability and solubility in polar solvents. Additionally, the cyclohexyl group can influence the compound's hydrophobic characteristics and steric effects, potentially affecting its interactions with other molecules. The compound may be of interest in various fields, including pharmaceuticals, agrochemicals, and materials science, due to its structural features that could lead to specific biological or chemical activities. As with many organic compounds, its physical properties, such as boiling point, melting point, and solubility, would depend on the molecular interactions and the environment in which it is studied. Safety and handling precautions should be observed, as with any chemical substance.

Formula: C₁₃H₂₂O₃

InChI: InChI=1S/C13H22O3/c14-12(10-13-15-8-9-16-13)7-6-11-4-2-1-3-5-11/h11,13H,1-10H2

InChI key: InChIKey=AHEIMZRJTVNJCX-UHFFFAOYSA-N

SMILES: C(C(CCC1CCCCC1)=O)C2OCCO2

Synonyms:

• 2-Butanone, 4-cyclohexyl-1-(1,3-dioxolan-2-yl)-
• 4-Cyclohexyl-1-(1,3-dioxolan-2-yl)-2-butanone