CAS 1263365-87-2

1-(2-Bromo-2-propen-1-yl)-2-ethylbenzene

Description:

1-(2-Bromo-2-propen-1-yl)-2-ethylbenzene, identified by its CAS number 1263365-87-2, is an organic compound characterized by the presence of both a brominated propenyl group and an ethyl-substituted benzene ring. This compound features a vinyl bromide moiety, which contributes to its reactivity, particularly in nucleophilic substitution and addition reactions. The ethyl group on the benzene ring enhances the hydrophobic character of the molecule, potentially influencing its solubility in organic solvents. The presence of the bromine atom introduces a polar functional group, which can affect the compound's physical properties, such as boiling point and density. Additionally, the compound may exhibit interesting chemical behavior due to the conjugation between the double bond of the propenyl group and the aromatic system, which can lead to various electrophilic aromatic substitution reactions. Overall, this compound's unique structure makes it a candidate for applications in organic synthesis and materials science, although specific reactivity and stability would depend on the reaction conditions and environment.

Formula: C₁₁H₁₃Br

InChI: InChI=1S/C11H13Br/c1-3-10-6-4-5-7-11(10)8-9(2)12/h4-7H,2-3,8H2,1H3

InChI key: InChIKey=CCUZQUWYXQKIOK-UHFFFAOYSA-N

SMILES: C(C(Br)=C)C1=C(CC)C=CC=C1

Synonyms:

• Benzene, 1-(2-bromo-2-propen-1-yl)-2-ethyl-
• 1-(2-Bromo-2-propen-1-yl)-2-ethylbenzene