CAS 1263365-90-7
:1-(2,6-Dimethylphenyl)-2-(1,3-dioxolan-2-yl)ethanone
Description:
1-(2,6-Dimethylphenyl)-2-(1,3-dioxolan-2-yl)ethanone, with the CAS number 1263365-90-7, is an organic compound characterized by its unique structure that includes a ketone functional group and a dioxolane ring. This compound features a 2,6-dimethylphenyl group, which contributes to its aromatic properties and potential hydrophobic interactions. The presence of the dioxolane moiety suggests that it may exhibit interesting solubility characteristics, potentially being soluble in organic solvents while having limited solubility in water. The compound may also display specific reactivity due to the ketone group, making it a candidate for various chemical reactions, including nucleophilic additions. Its structural features may impart biological activity, making it of interest in pharmaceutical or agrochemical research. Additionally, the compound's stability and reactivity can be influenced by factors such as temperature and pH, which are important considerations in its handling and application. Overall, this compound represents a versatile structure with potential applications in various fields of chemistry.
Formula:C13H16O3
InChI:InChI=1S/C13H16O3/c1-9-4-3-5-10(2)13(9)11(14)8-12-15-6-7-16-12/h3-5,12H,6-8H2,1-2H3
InChI key:InChIKey=MTNDWHMLHWVKOC-UHFFFAOYSA-N
SMILES:C(CC1OCCO1)(=O)C2=C(C)C=CC=C2C
Synonyms:- 1-(2,6-Dimethylphenyl)-2-(1,3-dioxolan-2-yl)ethanone
- Ethanone, 1-(2,6-dimethylphenyl)-2-(1,3-dioxolan-2-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.