CAS 1263365-91-8

1-(4-Butylphenyl)-2-(1,3-dioxolan-2-yl)ethanone

Description:

1-(4-Butylphenyl)-2-(1,3-dioxolan-2-yl)ethanone, identified by its CAS number 1263365-91-8, is an organic compound characterized by its unique structure that includes a butylphenyl group and a dioxolane moiety. This compound typically exhibits properties associated with both aromatic and cyclic ether functionalities, which may influence its solubility, reactivity, and stability. The presence of the butyl group enhances its hydrophobic characteristics, potentially affecting its interaction with biological systems and solvents. The dioxolane ring contributes to the compound's stability and may participate in various chemical reactions, such as nucleophilic attacks or ring-opening reactions under specific conditions. This compound may find applications in organic synthesis, materials science, or as an intermediate in the production of more complex molecules. Its specific physical and chemical properties, such as boiling point, melting point, and spectral characteristics, would require empirical measurement or detailed literature references for precise values. Overall, the compound's structure suggests potential utility in various chemical applications, particularly in the fields of organic chemistry and materials development.

Formula: C₁₅H₂₀O₃

InChI: InChI=1S/C15H20O3/c1-2-3-4-12-5-7-13(8-6-12)14(16)11-15-17-9-10-18-15/h5-8,15H,2-4,9-11H2,1H3

InChI key: InChIKey=XPZUJCHCWTWYMD-UHFFFAOYSA-N

SMILES: C(CC1OCCO1)(=O)C2=CC=C(CCCC)C=C2

Synonyms:

• 1-(4-Butylphenyl)-2-(1,3-dioxolan-2-yl)ethanone
• Ethanone, 1-(4-butylphenyl)-2-(1,3-dioxolan-2-yl)-