CymitQuimica logo

CAS 1263365-92-9

:

2-(1,3-Dioxolan-2-yl)-1-(4-ethoxyphenyl)ethanone

Description:
2-(1,3-Dioxolan-2-yl)-1-(4-ethoxyphenyl)ethanone is an organic compound characterized by its unique structural features, including a dioxolane ring and an ethoxy-substituted phenyl group. The presence of the dioxolane moiety suggests potential applications in the synthesis of various derivatives, as dioxolanes are often used as protective groups in organic synthesis. The compound's ethanone functional group indicates it possesses ketone characteristics, which can influence its reactivity and interactions with other chemical species. Additionally, the ethoxy group contributes to the compound's hydrophobic properties, potentially affecting its solubility and partitioning behavior in different solvents. This compound may exhibit interesting biological activities, making it a candidate for further research in medicinal chemistry. Its molecular structure suggests potential applications in materials science, particularly in the development of polymers or as intermediates in organic synthesis. Overall, the combination of functional groups in 2-(1,3-Dioxolan-2-yl)-1-(4-ethoxyphenyl)ethanone provides a versatile platform for various chemical transformations and applications.
Formula:C13H16O4
InChI:InChI=1S/C13H16O4/c1-2-15-11-5-3-10(4-6-11)12(14)9-13-16-7-8-17-13/h3-6,13H,2,7-9H2,1H3
InChI key:InChIKey=RGJCAJVIOMJLNQ-UHFFFAOYSA-N
SMILES:C(CC1OCCO1)(=O)C2=CC=C(OCC)C=C2
Synonyms:
  • 2-(1,3-Dioxolan-2-yl)-1-(4-ethoxyphenyl)ethanone
  • Ethanone, 2-(1,3-dioxolan-2-yl)-1-(4-ethoxyphenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.