CAS 1263365-94-1

1-(2,4-Dimethylphenyl)-2-(1,3-dioxolan-2-yl)ethanone

Description:

1-(2,4-Dimethylphenyl)-2-(1,3-dioxolan-2-yl)ethanone, identified by its CAS number 1263365-94-1, is an organic compound characterized by its unique molecular structure, which includes a ketone functional group and a dioxolane ring. This compound typically exhibits a moderate to high level of lipophilicity due to the presence of the aromatic dimethylphenyl group, which can influence its solubility in organic solvents. The dioxolane moiety contributes to its potential reactivity, particularly in nucleophilic substitution reactions. In terms of physical properties, it may present as a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. The compound's applications could span various fields, including organic synthesis and materials science, particularly in the development of specialty chemicals or as intermediates in the synthesis of more complex molecules. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken due to potential toxicity or reactivity.

Formula: C₁₃H₁₆O₃

InChI: InChI=1S/C13H16O3/c1-9-3-4-11(10(2)7-9)12(14)8-13-15-5-6-16-13/h3-4,7,13H,5-6,8H2,1-2H3

InChI key: InChIKey=XWENOTPRHBZWPR-UHFFFAOYSA-N

SMILES: C(CC1OCCO1)(=O)C2=C(C)C=C(C)C=C2

Synonyms:

• 1-(2,4-Dimethylphenyl)-2-(1,3-dioxolan-2-yl)ethanone
• Ethanone, 1-(2,4-dimethylphenyl)-2-(1,3-dioxolan-2-yl)-