CAS 1263365-98-5
:1-(3,4-Difluorophenyl)-2-(1,3-dioxolan-2-yl)ethanone
Description:
1-(3,4-Difluorophenyl)-2-(1,3-dioxolan-2-yl)ethanone is an organic compound characterized by its unique structural features, which include a difluorophenyl group and a dioxolane ring. The presence of the difluorophenyl moiety suggests that the compound may exhibit interesting electronic properties and potential reactivity due to the electronegative fluorine atoms. The dioxolane ring contributes to the compound's cyclic structure, which can influence its physical properties, such as solubility and stability. This compound may be of interest in medicinal chemistry and material science due to its potential biological activity and utility as a synthetic intermediate. Its molecular structure allows for various functionalization possibilities, making it a versatile building block in organic synthesis. Additionally, the compound's characteristics, such as melting point, boiling point, and spectral properties, would be essential for understanding its behavior in different environments and applications. Overall, 1-(3,4-Difluorophenyl)-2-(1,3-dioxolan-2-yl)ethanone represents a complex organic molecule with potential significance in various chemical fields.
Formula:C11H10F2O3
InChI:InChI=1S/C11H10F2O3/c12-8-2-1-7(5-9(8)13)10(14)6-11-15-3-4-16-11/h1-2,5,11H,3-4,6H2
InChI key:InChIKey=NHMYRVLBXXVAEW-UHFFFAOYSA-N
SMILES:C(CC1OCCO1)(=O)C2=CC(F)=C(F)C=C2
Synonyms:- Ethanone, 1-(3,4-difluorophenyl)-2-(1,3-dioxolan-2-yl)-
- 1-(3,4-Difluorophenyl)-2-(1,3-dioxolan-2-yl)ethanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.