CAS 1263365-99-6

1-(2,4-Dichlorophenyl)-2-(1,3-dioxolan-2-yl)ethanone

Description:

1-(2,4-Dichlorophenyl)-2-(1,3-dioxolan-2-yl)ethanone, identified by its CAS number 1263365-99-6, is a synthetic organic compound characterized by its unique molecular structure, which includes a dichlorophenyl group and a dioxolane ring. This compound typically exhibits properties associated with both aromatic and cyclic ether functionalities, contributing to its potential reactivity and stability. The presence of the dichlorophenyl moiety suggests that it may possess significant biological activity, potentially making it of interest in pharmaceutical applications. The dioxolane ring can enhance solubility and influence the compound's interaction with biological systems. In terms of physical properties, it may be a solid or liquid at room temperature, depending on its specific formulation and purity. Its synthesis likely involves multi-step organic reactions, and it may be analyzed using techniques such as NMR spectroscopy, mass spectrometry, and chromatography to confirm its structure and purity. As with many chemical substances, safety data sheets should be consulted for handling and toxicity information.

Formula: C₁₁H₁₀Cl₂O₃

InChI: InChI=1S/C11H10Cl2O3/c12-7-1-2-8(9(13)5-7)10(14)6-11-15-3-4-16-11/h1-2,5,11H,3-4,6H2

InChI key: InChIKey=TYQSFOJHMZSGSC-UHFFFAOYSA-N

SMILES: C(CC1OCCO1)(=O)C2=C(Cl)C=C(Cl)C=C2