CymitQuimica logo

CAS 1263366-01-3

:

1-(1,3-Dioxolan-2-yl)-4,4-dimethyl-2-pentanone

Description:
1-(1,3-Dioxolan-2-yl)-4,4-dimethyl-2-pentanone is an organic compound characterized by its unique structure, which includes a dioxolane ring and a ketone functional group. This compound typically exhibits properties associated with both cyclic ethers and ketones, such as moderate polarity and potential solubility in organic solvents. The presence of the dioxolane moiety may impart stability and influence its reactivity, making it useful in various chemical applications, including as a solvent or intermediate in organic synthesis. The compound's molecular structure suggests it may participate in nucleophilic reactions due to the electrophilic nature of the carbonyl group. Additionally, the branched alkyl groups can affect its physical properties, such as boiling point and viscosity. Safety data sheets would typically indicate handling precautions, as compounds with ketone functionalities can be flammable and may pose health risks upon exposure. Overall, this compound's characteristics make it a subject of interest in both industrial and research settings.
Formula:C10H18O3
InChI:InChI=1S/C10H18O3/c1-10(2,3)7-8(11)6-9-12-4-5-13-9/h9H,4-7H2,1-3H3
InChI key:InChIKey=LTSJHTNONJUKJT-UHFFFAOYSA-N
SMILES:C(C(CC(C)(C)C)=O)C1OCCO1
Synonyms:
  • 1-(1,3-Dioxolan-2-yl)-4,4-dimethyl-2-pentanone
  • 2-Pentanone, 1-(1,3-dioxolan-2-yl)-4,4-dimethyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.