CymitQuimica logo

CAS 1263366-02-4

:

2-(1,3-Dioxolan-2-yl)-1-[4-(trifluoromethyl)phenyl]ethanone

Description:
2-(1,3-Dioxolan-2-yl)-1-[4-(trifluoromethyl)phenyl]ethanone, identified by its CAS number 1263366-02-4, is an organic compound characterized by its unique structural features. It contains a dioxolane ring, which contributes to its potential reactivity and solubility properties. The presence of a trifluoromethyl group on the phenyl ring enhances its lipophilicity and may influence its biological activity, making it of interest in medicinal chemistry. This compound typically exhibits a moderate to high melting point and is likely to be stable under standard laboratory conditions. Its functional groups suggest potential applications in organic synthesis, particularly in the development of pharmaceuticals or agrochemicals. Additionally, the dioxolane moiety may impart properties such as increased polarity or the ability to participate in various chemical reactions, including nucleophilic attacks or cycloadditions. Overall, this compound's distinctive features make it a subject of interest for further research in both synthetic and applied chemistry contexts.
Formula:C12H11F3O3
InChI:InChI=1S/C12H11F3O3/c13-12(14,15)9-3-1-8(2-4-9)10(16)7-11-17-5-6-18-11/h1-4,11H,5-7H2
InChI key:InChIKey=HCRQKBYGSRWXDJ-UHFFFAOYSA-N
SMILES:C(CC1OCCO1)(=O)C2=CC=C(C(F)(F)F)C=C2
Synonyms:
  • 2-(1,3-Dioxolan-2-yl)-1-[4-(trifluoromethyl)phenyl]ethanone
  • Ethanone, 2-(1,3-dioxolan-2-yl)-1-[4-(trifluoromethyl)phenyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.