CymitQuimica logo

CAS 1263366-04-6

:

1-(2,3-Dichlorophenyl)-2-(1,3-dioxolan-2-yl)ethanone

Description:
1-(2,3-Dichlorophenyl)-2-(1,3-dioxolan-2-yl)ethanone, identified by its CAS number 1263366-04-6, is an organic compound characterized by its unique structural features. It contains a dichlorophenyl group, which contributes to its potential biological activity, and a dioxolane ring, which is known for its stability and ability to participate in various chemical reactions. This compound is likely to exhibit moderate to high lipophilicity due to the presence of aromatic and aliphatic components, influencing its solubility in organic solvents. The presence of the carbonyl group (ketone) suggests potential reactivity in nucleophilic addition reactions. Additionally, the dichlorophenyl moiety may impart specific electronic properties, affecting its reactivity and interaction with biological targets. While specific data on its toxicity and environmental impact may not be readily available, compounds with similar structures often warrant careful handling due to potential health risks. Overall, this compound's unique structure positions it as a candidate for further research in fields such as medicinal chemistry and material science.
Formula:C11H10Cl2O3
InChI:InChI=1S/C11H10Cl2O3/c12-8-3-1-2-7(11(8)13)9(14)6-10-15-4-5-16-10/h1-3,10H,4-6H2
InChI key:InChIKey=MJTAHNIRUBBCBD-UHFFFAOYSA-N
SMILES:C(CC1OCCO1)(=O)C2=C(Cl)C(Cl)=CC=C2
Synonyms:
  • 1-(2,3-Dichlorophenyl)-2-(1,3-dioxolan-2-yl)ethanone
  • Ethanone, 1-(2,3-dichlorophenyl)-2-(1,3-dioxolan-2-yl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.