CAS 1263366-05-7
:1-(2,6-Dichlorophenyl)-2-(1,3-dioxolan-2-yl)ethanone
Description:
1-(2,6-Dichlorophenyl)-2-(1,3-dioxolan-2-yl)ethanone, identified by its CAS number 1263366-05-7, is an organic compound characterized by its unique structure that includes a dichlorophenyl group and a dioxolane moiety. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, which may influence its reactivity and stability. The presence of the dichlorophenyl group suggests potential applications in pharmaceuticals or agrochemicals, as chlorinated aromatic compounds often exhibit significant biological activity. The dioxolane ring contributes to the compound's polarity and may enhance solubility in various solvents. Additionally, the ethanone functional group indicates that it may participate in typical carbonyl chemistry, such as nucleophilic addition or condensation reactions. Overall, this compound's characteristics, including its molecular weight, melting point, and solubility, would be essential for understanding its behavior in chemical reactions and potential applications in various fields. Further studies would be necessary to elucidate its specific properties and applications.
Formula:C11H10Cl2O3
InChI:InChI=1S/C11H10Cl2O3/c12-7-2-1-3-8(13)11(7)9(14)6-10-15-4-5-16-10/h1-3,10H,4-6H2
InChI key:InChIKey=MPMFBNBCZMLYDK-UHFFFAOYSA-N
SMILES:C(CC1OCCO1)(=O)C2=C(Cl)C=CC=C2Cl
Synonyms:- 1-(2,6-Dichlorophenyl)-2-(1,3-dioxolan-2-yl)ethanone
- Ethanone, 1-(2,6-dichlorophenyl)-2-(1,3-dioxolan-2-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.