CAS 1263366-07-9

1-(1,3-Dioxolan-2-yl)-2-nonanone

Description:

1-(1,3-Dioxolan-2-yl)-2-nonanone is a chemical compound characterized by its unique structure, which includes a dioxolane ring and a nonanone moiety. The presence of the 1,3-dioxolane ring contributes to its potential as a solvent or intermediate in organic synthesis, while the nonanone part indicates that it is a ketone, which typically exhibits distinctive reactivity due to the carbonyl group. This compound is likely to be a colorless to pale yellow liquid with a pleasant odor, typical of many ketones. Its solubility in organic solvents suggests it can be utilized in various applications, including fragrances, flavorings, or as a building block in the synthesis of more complex molecules. Additionally, the presence of the dioxolane ring may impart some degree of stability and influence its reactivity, making it an interesting subject for further study in organic chemistry and materials science. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance.

Formula: C₁₂H₂₂O₃

InChI: InChI=1S/C12H22O3/c1-2-3-4-5-6-7-11(13)10-12-14-8-9-15-12/h12H,2-10H2,1H3

InChI key: InChIKey=KLPLBNNWHXGJLQ-UHFFFAOYSA-N

SMILES: C(C(CCCCCCC)=O)C1OCCO1

Synonyms:

• 1-(1,3-Dioxolan-2-yl)-2-nonanone
• 2-Nonanone, 1-(1,3-dioxolan-2-yl)-