CAS 1263366-08-0
:2-(1,3-Dioxolan-2-yl)-1-(4-phenoxyphenyl)ethanone
Description:
2-(1,3-Dioxolan-2-yl)-1-(4-phenoxyphenyl)ethanone is an organic compound characterized by its unique structural features, which include a dioxolane ring and a phenoxyphenyl group. The presence of the dioxolane moiety suggests that this compound may exhibit properties such as stability and potential reactivity under certain conditions, particularly in organic synthesis. The phenoxyphenyl group contributes to the compound's aromatic character, which can influence its solubility, melting point, and overall chemical behavior. This compound may also display interesting photophysical properties, making it a candidate for applications in materials science, such as in the development of organic light-emitting diodes (OLEDs) or other electronic devices. Additionally, the presence of functional groups may allow for further chemical modifications, enhancing its utility in various chemical reactions. Overall, the combination of these structural elements suggests that 2-(1,3-Dioxolan-2-yl)-1-(4-phenoxyphenyl)ethanone could be a versatile compound in both research and industrial applications.
Formula:C17H16O4
InChI:InChI=1S/C17H16O4/c18-16(12-17-19-10-11-20-17)13-6-8-15(9-7-13)21-14-4-2-1-3-5-14/h1-9,17H,10-12H2
InChI key:InChIKey=HSKJSUXTUQQXSC-UHFFFAOYSA-N
SMILES:O(C1=CC=C(C(CC2OCCO2)=O)C=C1)C3=CC=CC=C3
Synonyms:- 2-(1,3-Dioxolan-2-yl)-1-(4-phenoxyphenyl)ethanone
- Ethanone, 2-(1,3-dioxolan-2-yl)-1-(4-phenoxyphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.