CymitQuimica logo

CAS 1263366-10-4

:

1-(3,4-Dimethoxyphenyl)-2-(1,3-dioxolan-2-yl)ethanone

Description:
1-(3,4-Dimethoxyphenyl)-2-(1,3-dioxolan-2-yl)ethanone, with the CAS number 1263366-10-4, is an organic compound characterized by its unique structural features. It contains a phenyl ring substituted with two methoxy groups at the 3 and 4 positions, which enhances its electron-donating properties and may influence its reactivity and solubility. The presence of a dioxolane ring contributes to its cyclic structure, potentially affecting its stability and interaction with other molecules. This compound is likely to exhibit moderate polarity due to the combination of hydrophobic aromatic and hydrophilic ether functionalities. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as the methoxy groups can modulate biological activity. Additionally, the compound may participate in various chemical reactions, including nucleophilic substitutions and cycloadditions, making it of interest for synthetic organic chemistry. Overall, its distinctive features position it as a compound of interest for further research and application in various chemical fields.
Formula:C13H16O5
InChI:InChI=1S/C13H16O5/c1-15-11-4-3-9(7-12(11)16-2)10(14)8-13-17-5-6-18-13/h3-4,7,13H,5-6,8H2,1-2H3
InChI key:InChIKey=DDOZXBRXARMCHX-UHFFFAOYSA-N
SMILES:C(CC1OCCO1)(=O)C2=CC(OC)=C(OC)C=C2
Synonyms:
  • Ethanone, 1-(3,4-dimethoxyphenyl)-2-(1,3-dioxolan-2-yl)-
  • 1-(3,4-Dimethoxyphenyl)-2-(1,3-dioxolan-2-yl)ethanone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.