CAS 1263366-11-5

1-(2,5-Dimethylphenyl)-2-(1,3-dioxolan-2-yl)ethanone

Description:

1-(2,5-Dimethylphenyl)-2-(1,3-dioxolan-2-yl)ethanone, with the CAS number 1263366-11-5, is an organic compound characterized by its unique structure that includes a ketone functional group and a dioxolane ring. This compound features a phenyl group substituted with two methyl groups at the 2 and 5 positions, contributing to its hydrophobic characteristics and potential for various chemical interactions. The presence of the dioxolane ring suggests that it may exhibit properties typical of cyclic ethers, such as increased stability and reactivity under certain conditions. This compound may be of interest in organic synthesis and materials science due to its potential applications in the development of pharmaceuticals, agrochemicals, or as a building block in polymer chemistry. Its specific reactivity and interactions would depend on the functional groups present and the overall molecular geometry, which can influence its behavior in different chemical environments. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.

Formula: C₁₃H₁₆O₃

InChI: InChI=1S/C13H16O3/c1-9-3-4-10(2)11(7-9)12(14)8-13-15-5-6-16-13/h3-4,7,13H,5-6,8H2,1-2H3

InChI key: InChIKey=XLFBPTQPXXVLOO-UHFFFAOYSA-N

SMILES: C(CC1OCCO1)(=O)C2=C(C)C=CC(C)=C2

Synonyms:

• 1-(2,5-Dimethylphenyl)-2-(1,3-dioxolan-2-yl)ethanone
• Ethanone, 1-(2,5-dimethylphenyl)-2-(1,3-dioxolan-2-yl)-