CAS 1263366-19-3

1-(1,3-Dioxolan-2-yl)-3-ethyl-2-pentanone

Description:

1-(1,3-Dioxolan-2-yl)-3-ethyl-2-pentanone, identified by its CAS number 1263366-19-3, is an organic compound characterized by its unique structure that includes a dioxolane ring and a ketone functional group. This compound typically exhibits properties associated with both cyclic ethers and ketones, such as moderate polarity and potential solubility in organic solvents. The presence of the dioxolane moiety may impart stability and influence its reactivity, making it of interest in various chemical applications, including synthesis and as a potential intermediate in organic reactions. Additionally, the ethyl group contributes to its hydrophobic characteristics, which can affect its interactions in biological systems or industrial processes. While specific physical properties like boiling point, melting point, and density may vary, compounds of this nature often demonstrate moderate volatility and can participate in hydrogen bonding due to the presence of oxygen atoms. Overall, 1-(1,3-Dioxolan-2-yl)-3-ethyl-2-pentanone represents a versatile structure within organic chemistry, with potential applications in pharmaceuticals and materials science.

Formula: C₁₀H₁₈O₃

InChI: InChI=1S/C10H18O3/c1-3-8(4-2)9(11)7-10-12-5-6-13-10/h8,10H,3-7H2,1-2H3

InChI key: InChIKey=OGAOHKDTHHAJJQ-UHFFFAOYSA-N

SMILES: C(C(C(CC)CC)=O)C1OCCO1

Synonyms:

• 2-Pentanone, 1-(1,3-dioxolan-2-yl)-3-ethyl-
• 1-(1,3-Dioxolan-2-yl)-3-ethyl-2-pentanone