CymitQuimica logo

CAS 1263376-05-1

:

2-Amino-5-bromo-N-cyclohexylbenzamide

Description:
2-Amino-5-bromo-N-cyclohexylbenzamide is a chemical compound characterized by its structural features, which include an amino group, a bromine atom, and a cyclohexyl group attached to a benzamide backbone. This compound typically exhibits properties associated with both amines and amides, such as potential solubility in polar solvents and the ability to participate in hydrogen bonding due to the presence of the amino and carbonyl functional groups. The bromine substituent can influence the compound's reactivity and stability, potentially making it a candidate for various chemical reactions, including nucleophilic substitutions. Additionally, the cyclohexyl group contributes to the compound's hydrophobic characteristics, which may affect its overall solubility and interaction with biological systems. The presence of the amino group suggests potential basicity, while the benzamide structure may impart some degree of aromatic stability. Overall, 2-Amino-5-bromo-N-cyclohexylbenzamide is of interest in medicinal chemistry and material science, where its unique properties can be leveraged for various applications.
Formula:C13H17BrN2O
InChI:InChI=1S/C13H17BrN2O/c14-9-6-7-12(15)11(8-9)13(17)16-10-4-2-1-3-5-10/h6-8,10H,1-5,15H2,(H,16,17)
InChI key:InChIKey=XMVGKUXWDCTWDP-UHFFFAOYSA-N
SMILES:C(NC1CCCCC1)(=O)C2=C(N)C=CC(Br)=C2
Synonyms:
  • Benzamide, 2-amino-5-bromo-N-cyclohexyl-
  • 2-Amino-5-bromo-N-cyclohexylbenzamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.