CAS 1263376-09-5

N-(4-Bromo-3-chloro-2-methylphenyl)thiourea

Description:

N-(4-Bromo-3-chloro-2-methylphenyl)thiourea is an organic compound characterized by the presence of a thiourea functional group attached to a substituted aromatic ring. The compound features a phenyl ring that is substituted with both bromine and chlorine atoms, which contribute to its reactivity and potential biological activity. The methyl group on the aromatic ring adds to its steric properties. This compound is typically used in research settings, particularly in the fields of medicinal chemistry and agrochemicals, due to its potential as a building block for more complex molecules. Its structure suggests that it may exhibit interesting interactions with biological targets, making it a candidate for further investigation in drug development. The presence of halogen substituents often enhances the lipophilicity and bioactivity of organic compounds. Safety and handling precautions should be observed due to the potential toxicity associated with halogenated compounds. As with any chemical, proper characterization and analysis are essential for understanding its properties and applications.

Formula: C₈H₈BrClN₂S

InChI: InChI=1S/C8H8BrClN2S/c1-4-6(12-8(11)13)3-2-5(9)7(4)10/h2-3H,1H3,(H3,11,12,13)

InChI key: InChIKey=WZTKQVUYKOTJFM-UHFFFAOYSA-N

SMILES: N(C(N)=S)C1=C(C)C(Cl)=C(Br)C=C1

Synonyms:

• N-(4-Bromo-3-chloro-2-methylphenyl)thiourea
• Thiourea, N-(4-bromo-3-chloro-2-methylphenyl)-