CymitQuimica logo

CAS 1263376-43-7

:

N-(4-Bromo-3,5-dichlorophenyl)thiourea

Description:
N-(4-Bromo-3,5-dichlorophenyl)thiourea is a chemical compound characterized by its thiourea functional group, which consists of a carbon atom double-bonded to a sulfur atom and single-bonded to an amine group. This compound features a phenyl ring substituted with bromine and dichlorine atoms, contributing to its unique reactivity and potential biological activity. The presence of halogen substituents can influence the compound's solubility, stability, and interaction with biological systems. Typically, thioureas are known for their applications in medicinal chemistry, particularly as potential antitumor agents or in the synthesis of various organic compounds. The specific arrangement of the bromine and chlorine atoms on the phenyl ring can affect the compound's electronic properties and steric hindrance, which may play a role in its reactivity and biological interactions. As with many halogenated compounds, safety precautions should be taken when handling this substance due to potential toxicity and environmental concerns.
Formula:C7H5BrCl2N2S
InChI:InChI=1S/C7H5BrCl2N2S/c8-6-4(9)1-3(2-5(6)10)12-7(11)13/h1-2H,(H3,11,12,13)
InChI key:InChIKey=AXYUZTOWRFPBHN-UHFFFAOYSA-N
SMILES:N(C(N)=S)C1=CC(Cl)=C(Br)C(Cl)=C1
Synonyms:
  • Thiourea, N-(4-bromo-3,5-dichlorophenyl)-
  • N-(4-Bromo-3,5-dichlorophenyl)thiourea
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.