CAS 1263376-61-9

2,5-Dibromo-3,6-difluorobenzoic acid

Description:

2,5-Dibromo-3,6-difluorobenzoic acid is an aromatic carboxylic acid characterized by the presence of two bromine atoms and two fluorine atoms substituted on a benzoic acid framework. The molecular structure features a benzene ring with the carboxylic acid (-COOH) functional group, which imparts acidic properties. The bromine and fluorine substituents contribute to the compound's reactivity and influence its physical properties, such as solubility and boiling point. Typically, halogenated benzoic acids exhibit increased lipophilicity, which can affect their behavior in biological systems and environmental interactions. The presence of multiple halogens can also enhance the compound's stability against degradation. This substance may be of interest in various fields, including pharmaceuticals and agrochemicals, due to its potential applications in synthesis and as a building block for more complex molecules. Safety data should be consulted for handling and disposal, as halogenated compounds can pose environmental and health risks.

Formula: C₇H₂Br₂F₂O₂

InChI: InChI=1S/C7H2Br2F2O2/c8-2-1-3(10)5(9)4(6(2)11)7(12)13/h1H,(H,12,13)

InChI key: InChIKey=ADTKZZCYCASGJX-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C(Br)C(F)=CC(Br)=C1F

Synonyms:

• Benzoic acid, 2,5-dibromo-3,6-difluoro-
• 2,5-Dibromo-3,6-difluorobenzoic acid