CAS 1263376-64-2

2′,2′,2′-Trifluoroisovaline ethyl ester

Description:

2′,2′,2′-Trifluoroisovaline ethyl ester is a synthetic compound characterized by the presence of a trifluoromethyl group and an isovaline structure, which is an amino acid derivative. This compound features a unique trifluoromethyl group that enhances its lipophilicity and may influence its biological activity. The ethyl ester functional group contributes to its solubility properties, making it potentially useful in various chemical applications, including pharmaceuticals and agrochemicals. The presence of fluorine atoms often imparts unique electronic properties, which can affect the compound's reactivity and interaction with biological systems. Additionally, the isovaline backbone suggests that it may exhibit chirality, leading to different enantiomers with potentially distinct biological effects. Overall, 2′,2′,2′-Trifluoroisovaline ethyl ester is of interest in research for its potential applications in medicinal chemistry and its role in the development of novel therapeutic agents.

Formula: C₇H₁₂F₃NO₂

InChI: InChI=1S/C7H12F3NO2/c1-3-6(11,7(8,9)10)5(12)13-4-2/h3-4,11H2,1-2H3

InChI key: InChIKey=PSCKFNXYQHKHNE-UHFFFAOYSA-N

SMILES: C(C(OCC)=O)(C(F)(F)F)(CC)N

Synonyms:

• Isovaline, 2′,2′,2′-trifluoro-, ethyl ester
• 2′,2′,2′-Trifluoroisovaline ethyl ester