CAS 1263376-69-7

Benzene, 1,4-difluoro-2-methyl-5-(trifluoromethyl)-

Description:

Benzene, 1,4-difluoro-2-methyl-5-(trifluoromethyl)-, also known by its CAS number 1263376-69-7, is a fluorinated aromatic compound characterized by a benzene ring substituted with multiple fluorine and methyl groups. The presence of the trifluoromethyl group (-CF3) and difluoro groups (-F) significantly influences its chemical properties, including increased lipophilicity and potential reactivity. This compound typically exhibits a high degree of stability due to the aromatic nature of the benzene ring, while the fluorine substituents can enhance its resistance to oxidation and degradation. The molecular structure suggests that it may have applications in various fields, including pharmaceuticals, agrochemicals, and materials science, particularly in the development of fluorinated compounds that exhibit unique electronic and physical properties. Additionally, the presence of multiple fluorine atoms can affect the compound's boiling point, melting point, and solubility in different solvents, making it an interesting subject for further study in organic chemistry and materials development.

Formula: C₈H₅F₅

InChI: InChI=1S/C8H5F5/c1-4-2-7(10)5(3-6(4)9)8(11,12)13/h2-3H,1H3

InChI key: InChIKey=RSZRFFOQSRYXIK-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C1=C(F)C=C(C)C(F)=C1

Synonyms:

• 1,4-Difluoro-2-methyl-5-(trifluoromethyl)benzene
• Benzene, 1,4-difluoro-2-methyl-5-(trifluoromethyl)-

1,4-Difluoro-2-methyl-5-(trifluoromethyl)benzene

CAS: 1263376-69-7

Versatile small molecule scaffold

Formula: C₈H₅F₅

Purity: Min. 95%

Molecular weight: 196.12 g/mol

Ref: 3D-NAC37669