CAS 1263376-80-2

2-(Trifluoromethyl)proline ethyl ester

Description:

2-(Trifluoromethyl)proline ethyl ester is a chemical compound characterized by the presence of a trifluoromethyl group attached to the proline structure, which is an amino acid known for its role in protein synthesis. This compound features an ethyl ester functional group, enhancing its solubility and reactivity. The trifluoromethyl group contributes to unique electronic properties, making the compound potentially useful in medicinal chemistry and material science. It is typically a white to off-white solid, and its molecular structure includes a five-membered pyrrolidine ring, which is characteristic of proline derivatives. The presence of fluorine atoms often imparts increased lipophilicity and metabolic stability, which can be advantageous in drug design. Additionally, the compound may exhibit interesting biological activities, although specific applications would depend on further research and characterization. Safety data and handling precautions should be observed, as with any fluorinated compound, due to potential toxicity and environmental concerns.

Formula: C₈H₁₂F₃NO₂

InChI: InChI=1S/C8H12F3NO2/c1-2-14-6(13)7(8(9,10)11)4-3-5-12-7/h12H,2-5H2,1H3

InChI key: InChIKey=IFLJOJOIEIPTOY-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C1(C(OCC)=O)CCCN1

Synonyms:

• Proline, 2-(trifluoromethyl)-, ethyl ester
• 2-(Trifluoromethyl)proline ethyl ester