CAS 1263376-84-6

2-Amino-5-bromo-N,N-diethylbenzamide

Description:

2-Amino-5-bromo-N,N-diethylbenzamide is an organic compound characterized by its amide functional group, which is derived from benzoic acid. The presence of the amino group (-NH2) and the bromo substituent (Br) on the benzene ring significantly influences its chemical reactivity and properties. The diethyl groups attached to the nitrogen atom contribute to the compound's lipophilicity, enhancing its solubility in organic solvents. This compound typically exhibits moderate stability under standard conditions but may undergo reactions such as nucleophilic substitution or electrophilic aromatic substitution due to the presence of the bromine atom. Its molecular structure suggests potential applications in pharmaceuticals or agrochemicals, where the amino and bromo functionalities can be leveraged for biological activity or as intermediates in synthesis. Additionally, the compound's characteristics, such as melting point, boiling point, and spectral properties, would be essential for its identification and application in various chemical contexts. Safety data and handling precautions should be considered due to the presence of bromine, which can be hazardous.

Formula: C₁₁H₁₅BrN₂O

InChI: InChI=1S/C11H15BrN2O/c1-3-14(4-2)11(15)9-7-8(12)5-6-10(9)13/h5-7H,3-4,13H2,1-2H3

InChI key: InChIKey=VDRQPOBAUKPRCP-UHFFFAOYSA-N

SMILES: C(N(CC)CC)(=O)C1=C(N)C=CC(Br)=C1

Synonyms:

• 2-Amino-5-bromo-N,N-diethylbenzamide
• Benzamide, 2-amino-5-bromo-N,N-diethyl-