CAS 1263376-91-5

2,3-Dichloro-5,6-difluorobenzoic acid

Description:

2,3-Dichloro-5,6-difluorobenzoic acid is an aromatic carboxylic acid characterized by the presence of two chlorine and two fluorine substituents on a benzoic acid framework. The chlorine atoms are located at the 2 and 3 positions, while the fluorine atoms are at the 5 and 6 positions of the benzene ring. This compound is typically a solid at room temperature and exhibits moderate solubility in organic solvents, with limited solubility in water due to its hydrophobic aromatic structure. The presence of electronegative halogens influences its chemical reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, the compound may exhibit interesting biological activity, which can be explored in pharmaceutical applications. Its unique structure and properties make it a subject of interest in both synthetic organic chemistry and materials science. Safety data should be consulted for handling, as halogenated compounds can pose environmental and health risks.

Formula: C₇H₂Cl₂F₂O₂

InChI: InChI=1S/C7H2Cl2F2O2/c8-2-1-3(10)6(11)4(5(2)9)7(12)13/h1H,(H,12,13)

InChI key: InChIKey=FJCBZAPTIBDPQA-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C(Cl)C(Cl)=CC(F)=C1F

Synonyms:

• 2,3-Dichloro-5,6-difluorobenzoic acid
• Benzoic acid, 2,3-dichloro-5,6-difluoro-