
CAS 1263376-92-6
:N-(2-Chloro-6-fluorophenyl)hydrazinecarbothioamide
Description:
N-(2-Chloro-6-fluorophenyl)hydrazinecarbothioamide is a chemical compound characterized by its unique structure, which includes a hydrazine moiety and a thiocarbonyl group. This compound features a chloro and a fluorine substituent on a phenyl ring, contributing to its potential reactivity and biological activity. The presence of the hydrazine functional group suggests that it may participate in various chemical reactions, including those typical of hydrazines, such as condensation and oxidation reactions. The thiocarbonyl group can enhance the compound's ability to form coordination complexes with metals or participate in nucleophilic addition reactions. Due to its specific functional groups, this compound may exhibit interesting pharmacological properties, making it a candidate for further research in medicinal chemistry. Additionally, its unique substituents may influence its solubility, stability, and interaction with biological targets. Overall, N-(2-Chloro-6-fluorophenyl)hydrazinecarbothioamide represents a compound of interest in both synthetic and medicinal chemistry contexts.
Formula:C7H7ClFN3S
InChI:InChI=1S/C7H7ClFN3S/c8-4-2-1-3-5(9)6(4)11-7(13)12-10/h1-3H,10H2,(H2,11,12,13)
InChI key:InChIKey=ITVRNBJQCFTFCI-UHFFFAOYSA-N
SMILES:N(C(NN)=S)C1=C(Cl)C=CC=C1F
Synonyms:- Hydrazinecarbothioamide, N-(2-chloro-6-fluorophenyl)-
- N-(2-Chloro-6-fluorophenyl)hydrazinecarbothioamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.