CAS 1263377-06-5

N-(2-Bromo-4-ethylphenyl)thiourea

Description:

N-(2-Bromo-4-ethylphenyl)thiourea is an organic compound characterized by the presence of a thiourea functional group, which consists of a carbon atom double-bonded to sulfur and single-bonded to two nitrogen atoms. The compound features a brominated aromatic ring, specifically a 2-bromo-4-ethylphenyl moiety, indicating the presence of a bromine atom and an ethyl group attached to the phenyl ring. This structure contributes to its potential reactivity and solubility properties. Thioureas are known for their diverse biological activities, including antimicrobial and anticancer properties, making this compound of interest in medicinal chemistry. Additionally, the presence of the bromine substituent can enhance the compound's reactivity in various chemical reactions, such as nucleophilic substitutions or coupling reactions. The compound's physical properties, such as melting point, boiling point, and solubility, would depend on its molecular interactions and the specific conditions under which it is studied. Overall, N-(2-Bromo-4-ethylphenyl)thiourea represents a unique structure with potential applications in pharmaceuticals and organic synthesis.

Formula: C₉H₁₁BrN₂S

InChI: InChI=1S/C9H11BrN2S/c1-2-6-3-4-8(7(10)5-6)12-9(11)13/h3-5H,2H2,1H3,(H3,11,12,13)

InChI key: InChIKey=POXOKPZMLZXMEW-UHFFFAOYSA-N

SMILES: N(C(N)=S)C1=C(Br)C=C(CC)C=C1

Synonyms:

• N-(2-Bromo-4-ethylphenyl)thiourea
• Thiourea, N-(2-bromo-4-ethylphenyl)-