CAS 1263377-16-7

2-(2-Carboxyphenyl)-4-pyridinecarboxylic acid

Description:

2-(2-Carboxyphenyl)-4-pyridinecarboxylic acid, also known by its CAS number 1263377-16-7, is an organic compound characterized by the presence of both carboxylic acid and pyridine functional groups. This compound features a biphenyl structure where one phenyl ring is substituted with a carboxylic acid group and the other is connected to a pyridine ring, which also contains a carboxylic acid group. The presence of these functional groups suggests that the compound may exhibit acidic properties, potentially forming salts or esters under appropriate conditions. Its molecular structure allows for various intermolecular interactions, such as hydrogen bonding, which can influence its solubility and reactivity. This compound may have applications in pharmaceuticals, agrochemicals, or as a ligand in coordination chemistry due to its ability to chelate metal ions. Additionally, its unique structure may contribute to specific biological activities, making it a subject of interest in medicinal chemistry research.

Formula: C₁₃H₉NO₄

InChI: InChI=1S/C13H9NO4/c15-12(16)8-5-6-14-11(7-8)9-3-1-2-4-10(9)13(17)18/h1-7H,(H,15,16)(H,17,18)

InChI key: InChIKey=XJDLZHYNGYTQHI-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C(C=CC=C1)C2=CC(C(O)=O)=CC=N2

Synonyms:

• 4-Pyridinecarboxylic acid, 2-(2-carboxyphenyl)-
• 2-(2-Carboxyphenyl)-4-pyridinecarboxylic acid