
CAS 1263377-28-1
:5-(2-Carboxyphenyl)-3-pyridinecarboxylic acid
Description:
5-(2-Carboxyphenyl)-3-pyridinecarboxylic acid, also known by its CAS number 1263377-28-1, is an organic compound characterized by its dual carboxylic acid functional groups and a pyridine ring. This compound features a pyridine moiety substituted at the 3-position with a carboxylic acid and a phenyl group that carries a carboxylic acid at the 2-position. The presence of these functional groups suggests that it may exhibit acidic properties, potentially forming salts or esters under appropriate conditions. The compound's structure indicates it may participate in hydrogen bonding due to the carboxylic acid groups, influencing its solubility and reactivity. Additionally, the aromatic nature of the phenyl and pyridine rings may contribute to its stability and potential applications in pharmaceuticals or as a ligand in coordination chemistry. Its unique structure could also allow for various synthetic modifications, making it a compound of interest in organic synthesis and medicinal chemistry.
Formula:C13H9NO4
InChI:InChI=1S/C13H9NO4/c15-12(16)9-5-8(6-14-7-9)10-3-1-2-4-11(10)13(17)18/h1-7H,(H,15,16)(H,17,18)
InChI key:InChIKey=ORPRULFZPAZQBQ-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(C=CC=C1)C=2C=C(C(O)=O)C=NC2
Synonyms:- 3-Pyridinecarboxylic acid, 5-(2-carboxyphenyl)-
- 5-(2-Carboxyphenyl)-3-pyridinecarboxylic acid
- 5-(2-Carboxyphenyl)nicotinic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.