CAS 1263377-45-2

N-[2-Bromo-4-(trifluoromethoxy)phenyl]thiourea

Description:

N-[2-Bromo-4-(trifluoromethoxy)phenyl]thiourea is a chemical compound characterized by its unique structure, which includes a thiourea functional group and a brominated aromatic ring with a trifluoromethoxy substituent. This compound typically exhibits properties associated with both thioureas and halogenated aromatic compounds, such as potential biological activity and reactivity due to the presence of the bromine atom and the trifluoromethoxy group. The trifluoromethoxy group can enhance lipophilicity and influence the compound's interaction with biological targets. Additionally, the presence of the thiourea moiety may impart specific pharmacological properties, making it of interest in medicinal chemistry. The compound's solubility, stability, and reactivity can vary based on environmental conditions and the presence of other functional groups. As with many halogenated compounds, it may also exhibit unique spectral characteristics in techniques such as NMR and IR spectroscopy, aiding in its identification and characterization. Safety and handling precautions should be observed due to potential toxicity associated with brominated and fluorinated compounds.

Formula: C₈H₆BrF₃N₂OS

InChI: InChI=1S/C8H6BrF3N2OS/c9-5-3-4(15-8(10,11)12)1-2-6(5)14-7(13)16/h1-3H,(H3,13,14,16)

InChI key: InChIKey=MZQGTYITKGNIKU-UHFFFAOYSA-N

SMILES: O(C(F)(F)F)C1=CC(Br)=C(NC(N)=S)C=C1

Synonyms:

• Thiourea, N-[2-bromo-4-(trifluoromethoxy)phenyl]-
• N-[2-Bromo-4-(trifluoromethoxy)phenyl]thiourea