CAS 1263377-51-0

3-Bromo-4-iodo-5-methylbenzenamine

Description:

3-Bromo-4-iodo-5-methylbenzenamine, with the CAS number 1263377-51-0, is an organic compound that belongs to the class of aromatic amines. Its structure features a benzene ring substituted with a bromine atom at the 3-position, an iodine atom at the 4-position, and a methyl group at the 5-position, along with an amino group (-NH2) attached to the benzene ring. This compound is characterized by its potential reactivity due to the presence of halogen substituents, which can influence its electrophilic aromatic substitution reactions. The amino group contributes to its basicity and can participate in various chemical reactions, including nucleophilic substitutions. The presence of both bromine and iodine makes it a subject of interest in synthetic organic chemistry, particularly in the development of pharmaceuticals and agrochemicals. Additionally, the compound's physical properties, such as solubility and melting point, can vary based on the specific conditions and solvents used. Safety precautions should be taken when handling this compound due to the potential toxicity associated with aromatic amines and halogenated compounds.

Formula: C₇H₇BrIN

InChI: InChI=1S/C7H7BrIN/c1-4-2-5(10)3-6(8)7(4)9/h2-3H,10H2,1H3

InChI key: InChIKey=XDCQTEGLMYCXRA-UHFFFAOYSA-N

SMILES: IC1=C(Br)C=C(N)C=C1C

Synonyms:

• Benzenamine, 3-bromo-4-iodo-5-methyl-
• 3-Bromo-4-iodo-5-methylbenzenamine