
CAS 1263377-61-2
:5-(2-Benzofuranyl)-3-pyridinecarboxylic acid
Description:
5-(2-Benzofuranyl)-3-pyridinecarboxylic acid is a chemical compound characterized by its unique structure, which combines a benzofuran moiety with a pyridinecarboxylic acid. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, including potential biological activity due to the presence of the pyridine ring. The benzofuran component contributes to its aromatic character, while the carboxylic acid functional group can participate in hydrogen bonding and influence solubility and reactivity. The compound may be of interest in medicinal chemistry, particularly for its potential pharmacological properties. Its molecular interactions could be relevant in drug design, especially in targeting specific biological pathways. Additionally, the presence of both the benzofuran and pyridine rings may enhance its lipophilicity, affecting its absorption and distribution in biological systems. Overall, 5-(2-Benzofuranyl)-3-pyridinecarboxylic acid represents a versatile structure that could be explored for various applications in organic synthesis and pharmaceutical development.
Formula:C14H9NO3
InChI:InChI=1S/C14H9NO3/c16-14(17)11-5-10(7-15-8-11)13-6-9-3-1-2-4-12(9)18-13/h1-8H,(H,16,17)
InChI key:InChIKey=VYYIUNLKILYDAU-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=CC(C2=CC=3C(O2)=CC=CC3)=CN=C1
Synonyms:- 5-(2-Benzofuranyl)-3-pyridinecarboxylic acid
- 3-Pyridinecarboxylic acid, 5-(2-benzofuranyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.