
CAS 1263377-65-6
:1,3-Dibromo-4-iodo-2-methylbenzene
Description:
1,3-Dibromo-4-iodo-2-methylbenzene, with the CAS number 1263377-65-6, is an organic compound belonging to the class of halogenated aromatic hydrocarbons. It features a benzene ring substituted with two bromine atoms at the 1 and 3 positions, an iodine atom at the 4 position, and a methyl group at the 2 position. This compound is characterized by its relatively high molecular weight and the presence of multiple halogen substituents, which can significantly influence its reactivity and physical properties. The presence of bromine and iodine atoms typically enhances the compound's electrophilic character, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. Additionally, the methyl group contributes to the compound's hydrophobic nature, affecting its solubility in polar and non-polar solvents. The unique arrangement of substituents also suggests potential applications in organic synthesis and materials science, particularly in the development of functionalized polymers or as intermediates in the synthesis of more complex molecules.
Formula:C7H5Br2I
InChI:InChI=1S/C7H5Br2I/c1-4-5(8)2-3-6(10)7(4)9/h2-3H,1H3
InChI key:InChIKey=DHCRCOHZTWTMPK-UHFFFAOYSA-N
SMILES:BrC1=C(C)C(Br)=CC=C1I
Synonyms:- Benzene, 1,3-dibromo-4-iodo-2-methyl-
- 1,3-Dibromo-4-iodo-2-methylbenzene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.