CymitQuimica logo

CAS 1263377-69-0

:

Benzamide, 2-amino-5-bromo-N-cyclopropyl-

Description:
Benzamide, 2-amino-5-bromo-N-cyclopropyl- is an organic compound characterized by the presence of a benzamide functional group, an amino group, and a bromine atom at the 5-position of the benzene ring. The cyclopropyl group attached to the nitrogen of the amide contributes to its unique properties. This compound is likely to exhibit moderate solubility in polar solvents due to the presence of the amino group, while the aromatic ring may provide some hydrophobic character. The bromine substituent can influence the compound's reactivity, potentially participating in electrophilic aromatic substitution reactions or serving as a leaving group in nucleophilic substitutions. Additionally, the cyclopropyl moiety may impart strain, affecting the compound's overall stability and reactivity. Such compounds are often of interest in medicinal chemistry for their potential biological activities, including antimicrobial or anticancer properties. However, specific biological or chemical properties would require empirical investigation to fully understand their behavior in various environments.
Formula:C10H11BrN2O
InChI:InChI=1S/C10H11BrN2O/c11-6-1-4-9(12)8(5-6)10(14)13-7-2-3-7/h1,4-5,7H,2-3,12H2,(H,13,14)
InChI key:InChIKey=HJGALSGTDWHWKU-UHFFFAOYSA-N
SMILES:C(NC1CC1)(=O)C2=C(N)C=CC(Br)=C2
Synonyms:
  • 2-Amino-5-bromo-N-cyclopropylbenzamide
  • Benzamide, 2-amino-5-bromo-N-cyclopropyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.