CAS 1263377-70-3

1,1-Dimethylethyl N-[2-[(2-amino-5-chlorobenzoyl)amino]ethyl]carbamate

Description:

1,1-Dimethylethyl N-[2-[(2-amino-5-chlorobenzoyl)amino]ethyl]carbamate, identified by its CAS number 1263377-70-3, is a chemical compound that features a complex structure characterized by the presence of a carbamate functional group. This compound includes a dimethyl group, which contributes to its steric hindrance, and an amino group that enhances its potential for biological activity. The presence of a chlorobenzoyl moiety suggests that it may exhibit specific interactions with biological targets, potentially influencing its pharmacological properties. The compound's solubility, stability, and reactivity can be influenced by the functional groups present, making it of interest in medicinal chemistry and drug development. Additionally, the chlorine substituent may affect its lipophilicity and overall bioavailability. Overall, this compound's unique structural features position it as a candidate for further investigation in therapeutic applications, particularly in the context of targeted drug design.

Formula: C₁₄H₂₀ClN₃O₃

InChI: InChI=1S/C14H20ClN3O3/c1-14(2,3)21-13(20)18-7-6-17-12(19)10-8-9(15)4-5-11(10)16/h4-5,8H,6-7,16H2,1-3H3,(H,17,19)(H,18,20)

InChI key: InChIKey=SBOVMIYXXJTYBK-UHFFFAOYSA-N

SMILES: C(NCCNC(OC(C)(C)C)=O)(=O)C1=C(N)C=CC(Cl)=C1

Synonyms:

• 1,1-Dimethylethyl N-[2-[(2-amino-5-chlorobenzoyl)amino]ethyl]carbamate
• [2-(2-Amino-5-chloro-benzoylamino)-ethyl]-carbamic acid tert-butyl ester
• Carbamic acid, N-[2-[(2-amino-5-chlorobenzoyl)amino]ethyl]-, 1,1-dimethylethyl ester