CAS 1263377-83-8

N-(4-Bromo-5-fluoro-2-methylphenyl)thiourea

Description:

N-(4-Bromo-5-fluoro-2-methylphenyl)thiourea is an organic compound characterized by the presence of a thiourea functional group attached to a substituted aromatic ring. The structure features a phenyl ring with bromine and fluorine substituents, which contribute to its unique chemical properties. The presence of the thiourea moiety imparts potential biological activity, making it of interest in medicinal chemistry. This compound may exhibit varying solubility in polar and non-polar solvents due to the influence of the halogen substituents and the thiourea group. Its molecular interactions can be influenced by hydrogen bonding capabilities, given the presence of the thiourea nitrogen atoms. Additionally, the compound's reactivity may be affected by the electron-withdrawing nature of the bromine and fluorine atoms, which can stabilize certain reaction intermediates. Overall, N-(4-Bromo-5-fluoro-2-methylphenyl)thiourea represents a class of compounds that may have applications in pharmaceuticals or agrochemicals, warranting further investigation into its properties and potential uses.

Formula: C₈H₈BrFN₂S

InChI: InChI=1S/C8H8BrFN2S/c1-4-2-5(9)6(10)3-7(4)12-8(11)13/h2-3H,1H3,(H3,11,12,13)

InChI key: InChIKey=FDKNOWNUSBPGNQ-UHFFFAOYSA-N

SMILES: N(C(N)=S)C1=C(C)C=C(Br)C(F)=C1

Synonyms:

• N-(4-Bromo-5-fluoro-2-methylphenyl)thiourea
• Thiourea, N-(4-bromo-5-fluoro-2-methylphenyl)-