CAS 1263377-92-9

3-Morpholinecarboxylic acid, 4-(phenylmethyl)-, hydrochloride (1:1)

Description:

3-Morpholinecarboxylic acid, 4-(phenylmethyl)-, hydrochloride (1:1) is a chemical compound characterized by its morpholine and carboxylic acid functional groups, along with a phenylmethyl substituent. This compound typically appears as a white to off-white crystalline solid and is soluble in water due to the presence of the hydrochloride salt form, which enhances its solubility compared to the free base. The morpholine ring contributes to its basicity and potential biological activity, while the carboxylic acid group can participate in various chemical reactions, such as esterification or amidation. The phenylmethyl group may influence the compound's lipophilicity and interaction with biological targets. This substance is of interest in pharmaceutical research and development, particularly for its potential applications in medicinal chemistry. Safety data should be consulted for handling and storage, as with any chemical compound, to ensure proper laboratory practices are followed.

Formula: C₁₂H₁₅NO₃·ClH

InChI: InChI=1S/C12H15NO3.ClH/c14-12(15)11-9-16-7-6-13(11)8-10-4-2-1-3-5-10;/h1-5,11H,6-9H2,(H,14,15);1H

InChI key: InChIKey=NWUIYCLMWGEVSH-UHFFFAOYSA-N

SMILES: C(N1C(C(O)=O)COCC1)C2=CC=CC=C2.Cl

Synonyms:

• 3-Morpholinecarboxylic acid, 4-(phenylmethyl)-, hydrochloride (1:1)