CAS 1263377-97-4

2-Piperazinepropanoic acid, 2,2,2-trifluoroacetate (1:2)

Description:

2-Piperazinepropanoic acid, 2,2,2-trifluoroacetate (1:2) is a chemical compound characterized by its piperazine backbone, which is a six-membered ring containing two nitrogen atoms. This compound features a propanoic acid moiety, contributing to its acidic properties, and is further modified by the presence of a trifluoroacetate group, which enhances its lipophilicity and may influence its biological activity. The trifluoroacetate group is known for its electron-withdrawing properties, which can affect the compound's reactivity and stability. This substance is typically used in pharmaceutical research and development due to its potential applications in drug design, particularly in the development of compounds with specific biological activities. Its unique structural features may also allow for interactions with various biological targets, making it of interest in medicinal chemistry. As with many chemical substances, safety data and handling precautions should be observed, given the potential hazards associated with its components.

Formula: C₇H₁₄N₂O₂·2C₂HF₃O₂

InChI: InChI=1S/C7H14N2O2.C2HF3O2/c10-7(11)2-1-6-5-8-3-4-9-6;3-2(4,5)1(6)7/h6,8-9H,1-5H2,(H,10,11);(H,6,7)

InChI key: InChIKey=HUZGRDDKMFEBET-UHFFFAOYSA-N

SMILES: C(CC(O)=O)C1CNCCN1.C(C(O)=O)(F)(F)F

Synonyms:

• 2-Piperazinepropanoic acid, 2,2,2-trifluoroacetate (1:2)

3-(Piperazin-2-yl)propanoic acid; bis(trifluoroacetic acid)

CAS: 1263377-97-4

3-(Piperazin-2-yl)propanoic acid; bis(trifluoroacetic acid)

Molecular weight: 386.24496g/mol

Ref: 54-PC107206