CymitQuimica logo

CAS 1263378-06-8

:

4(1H)-Quinolinone, 7-bromo-2,3-dihydro-, hydrochloride (1:1)

Description:
4(1H)-Quinolinone, 7-bromo-2,3-dihydro-, hydrochloride (1:1) is a chemical compound characterized by its quinolinone structure, which is a bicyclic compound containing a fused benzene and pyridine ring. The presence of a bromine atom at the 7-position contributes to its reactivity and potential applications in medicinal chemistry. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its bioavailability for pharmaceutical applications. This compound may exhibit various biological activities, making it of interest in drug development and research. Its molecular structure suggests potential interactions with biological targets, which can be explored for therapeutic purposes. The CAS number 1263378-06-8 uniquely identifies this substance, facilitating its recognition in scientific literature and databases. Safety and handling precautions should be observed, as with many halogenated organic compounds, due to potential toxicity and environmental impact. Overall, this compound represents a significant area of interest in organic and medicinal chemistry.
Formula:C9H8BrNO·ClH
InChI:InChI=1S/C9H8BrNO.ClH/c10-6-1-2-7-8(5-6)11-4-3-9(7)12;/h1-2,5,11H,3-4H2;1H
InChI key:InChIKey=CFRSMQPEJVSTTQ-UHFFFAOYSA-N
SMILES:O=C1C=2C(=CC(Br)=CC2)NCC1.Cl
Synonyms:
  • 4(1H)-Quinolinone, 7-bromo-2,3-dihydro-, hydrochloride (1:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.