CymitQuimica logo

CAS 1263378-09-1

:

2-(2-Pyrrolidinyl)-4-pyrimidinamine

Description:
2-(2-Pyrrolidinyl)-4-pyrimidinamine, identified by its CAS number 1263378-09-1, is a chemical compound characterized by its pyrimidine and pyrrolidine moieties. This substance typically exhibits properties associated with heterocyclic compounds, including potential basicity due to the presence of nitrogen atoms in its structure. The pyrimidine ring contributes to its aromatic character, while the pyrrolidine ring adds to its cyclic amine properties. Such compounds often demonstrate biological activity, making them of interest in medicinal chemistry and drug development. The presence of amino groups can enhance solubility in polar solvents and may influence the compound's reactivity and interaction with biological targets. Additionally, the structural features suggest potential applications in areas such as pharmacology, where modifications to the nitrogen-containing rings can lead to variations in activity and selectivity. Overall, 2-(2-Pyrrolidinyl)-4-pyrimidinamine represents a class of compounds that may serve as valuable scaffolds in the synthesis of therapeutically relevant molecules.
Formula:C8H12N4
InChI:InChI=1S/C8H12N4/c9-7-3-5-11-8(12-7)6-2-1-4-10-6/h3,5-6,10H,1-2,4H2,(H2,9,11,12)
InChI key:InChIKey=UGEJULLEHOXYPW-UHFFFAOYSA-N
SMILES:NC1=NC(=NC=C1)C2CCCN2
Synonyms:
  • 4-Pyrimidinamine, 2-(2-pyrrolidinyl)-
  • 2-(2-Pyrrolidinyl)-4-pyrimidinamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.