CymitQuimica logo

CAS 1263378-10-4

:

1,2,3,4-Tetrahydro-4,4-dimethyl-6-nitroquinoline

Description:
1,2,3,4-Tetrahydro-4,4-dimethyl-6-nitroquinoline is a chemical compound characterized by its bicyclic structure, which includes a quinoline moiety. This compound features a tetrahydro configuration, indicating that it contains a saturated ring system, and is further substituted with two methyl groups at the 4-position and a nitro group at the 6-position. The presence of the nitro group introduces significant polarity and potential reactivity, making it a candidate for various chemical reactions, including nitration and reduction processes. The compound's molecular structure suggests it may exhibit interesting biological activities, potentially serving as a lead compound in pharmaceutical research. Its physical properties, such as solubility and melting point, would depend on the specific arrangement of its functional groups and the overall molecular interactions. As with many nitrogen-containing heterocycles, it may also show potential as a ligand in coordination chemistry or as an intermediate in organic synthesis. Safety and handling precautions should be observed due to the presence of the nitro group, which can be hazardous under certain conditions.
Formula:C11H14N2O2
InChI:InChI=1S/C11H14N2O2/c1-11(2)5-6-12-10-4-3-8(13(14)15)7-9(10)11/h3-4,7,12H,5-6H2,1-2H3
InChI key:InChIKey=SJBDPELMMKAMOC-UHFFFAOYSA-N
SMILES:CC1(C)C=2C(=CC=C(N(=O)=O)C2)NCC1
Synonyms:
  • 1,2,3,4-Tetrahydro-4,4-dimethyl-6-nitroquinoline
  • Quinoline, 1,2,3,4-tetrahydro-4,4-dimethyl-6-nitro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.