CAS 1263378-11-5
:3-Bromo-6-nitrobenzo[b]thiophene
Description:
3-Bromo-6-nitrobenzo[b]thiophene is a heterocyclic organic compound characterized by the presence of a bromine atom and a nitro group attached to a benzo[b]thiophene ring system. This compound features a fused aromatic ring structure that incorporates a thiophene moiety, which contributes to its unique chemical properties. The bromine substituent typically enhances the compound's reactivity, making it useful in various synthetic applications, while the nitro group can serve as a potential site for further chemical modifications. The presence of these functional groups suggests that 3-Bromo-6-nitrobenzo[b]thiophene may exhibit interesting electronic properties, potentially making it valuable in materials science or medicinal chemistry. Additionally, the compound's structure may influence its solubility, stability, and interaction with biological systems, which are important factors in its potential applications. As with many organic compounds, safety and handling precautions should be observed due to the presence of halogen and nitro groups, which can impart toxicity or environmental concerns.
Formula:C8H4BrNO2S
InChI:InChI=1S/C8H4BrNO2S/c9-7-4-13-8-3-5(10(11)12)1-2-6(7)8/h1-4H
InChI key:InChIKey=CXDYUPRHJODLJC-UHFFFAOYSA-N
SMILES:BrC=1C=2C(=CC(N(=O)=O)=CC2)SC1
Synonyms:- 3-Bromo-6-nitrobenzo[b]thiophene
- Benzo[b]thiophene, 3-bromo-6-nitro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.