CAS 1263378-28-4

4H-Pyrido[1,2-a]pyrazin-4-one, octahydro-, hydrochloride (1:1)

Description:

4H-Pyrido[1,2-a]pyrazin-4-one, octahydro-, hydrochloride (1:1) is a chemical compound characterized by its bicyclic structure, which incorporates both pyridine and pyrazine rings. This compound typically exhibits properties associated with heterocyclic compounds, including potential biological activity due to its nitrogen-containing framework. The octahydro designation indicates that the compound is fully saturated, suggesting it may have a stable, non-aromatic structure. As a hydrochloride salt, it is likely to be more soluble in water compared to its free base form, which can enhance its bioavailability in pharmaceutical applications. The presence of the hydrochloride group also implies that it may exhibit acidic properties, influencing its behavior in various chemical environments. This compound may be of interest in medicinal chemistry, particularly for its potential therapeutic applications, although specific biological activities and mechanisms would require further investigation. Overall, its unique structural features and solubility characteristics make it a compound of interest in both research and potential drug development contexts.

Formula: C₈H₁₄N₂O·ClH

InChI: InChI=1S/C8H14N2O.ClH/c11-8-6-9-5-7-3-1-2-4-10(7)8;/h7,9H,1-6H2;1H

InChI key: InChIKey=BCPODMBFNHWHTJ-UHFFFAOYSA-N

SMILES: O=C1N2C(CNC1)CCCC2.Cl

Synonyms:

• 4H-Pyrido[1,2-a]pyrazin-4-one, octahydro-, hydrochloride (1:1)

4H-Pyrido[1,2-a]pyrazin-4-one, octahydro-, hydrochloride (1:1)

CAS: 1263378-28-4

Formula: C₈H₁₅ClN₂O

Purity: 95%

Molecular weight: 190.6705

Ref: IN-DA000SOR

Hexahydro-1H-pyrido[1,2-a]pyrazin-4(6H)-one hydrochloride

CAS: 1263378-28-4

Purity: 95.0%

Molecular weight: 190.6699981689453

Ref: 10-F454570