CAS 1263378-29-5

Cyclohexanol, 3-amino-, hydrochloride (1:1)

Description:

Cyclohexanol, 3-amino-, hydrochloride (1:1) is a chemical compound characterized by its amine and alcohol functional groups, specifically featuring a cyclohexanol structure with an amino group positioned at the third carbon. As a hydrochloride salt, it is typically encountered in a solid form, which enhances its solubility in water compared to its free base form. This compound is likely to exhibit properties typical of both alcohols and amines, such as hydrogen bonding capabilities, which can influence its reactivity and interactions in various chemical environments. The presence of the amino group suggests potential applications in pharmaceuticals or as a building block in organic synthesis. Additionally, the hydrochloride form may provide stability and ease of handling, making it suitable for laboratory and industrial applications. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance.

Formula: C₆H₁₃NO·ClH

InChI: InChI=1S/C6H13NO.ClH/c7-5-2-1-3-6(8)4-5;/h5-6,8H,1-4,7H2;1H

InChI key: InChIKey=NJGXTVICXVECGR-UHFFFAOYSA-N

SMILES: NC1CC(O)CCC1.Cl

Synonyms:

• 3-Aminocyclohexanol hydrochloride
• Cyclohexanol, 3-amino-, hydrochloride (1:1)

Cyclohexanol, 3-amino-, hydrochloride (1:1)

CAS: 1263378-29-5

Formula: C₆H₁₄ClNO

Purity: 95%

Color and Shape: Solid

Molecular weight: 151.6345

Ref: IN-DA000SOQ

3-Aminocyclohexanol hydrochloride

CAS: 1263378-29-5

3-Aminocyclohexanol hydrochloride

Purity: 96%

Molecular weight: 151.64g/mol

Ref: 54-OR1065201

3-Aminocyclohexanol hydrochloride

CAS: 1263378-29-5

Versatile small molecule scaffold

Formula: C₆H₁₃NO·HCl

Purity: Min. 95%

Molecular weight: 151.64 g/mol

Ref: 3D-NAC37829