CymitQuimica logo

CAS 1263378-32-0

:

3-Pyridinol, 6-amino-5-chloro-, hydrochloride (1:1)

Description:
3-Pyridinol, 6-amino-5-chloro-, hydrochloride (1:1) is a chemical compound characterized by its pyridine ring structure, which includes a hydroxyl group at the 3-position, an amino group at the 6-position, and a chlorine atom at the 5-position. This compound exists as a hydrochloride salt, indicating that it is typically encountered in its protonated form, which enhances its solubility in water. The presence of the amino and hydroxyl groups suggests potential for hydrogen bonding, influencing its reactivity and interaction with biological systems. It may exhibit properties typical of both pyridine derivatives and amino compounds, such as basicity and potential for nucleophilic substitution reactions. The compound's specific applications and biological activity would depend on its structural features, making it of interest in medicinal chemistry and related fields. As with many chemical substances, safety data and handling precautions should be consulted, as the presence of chlorine and amino groups may impart specific hazards.
Formula:C5H5ClN2O·ClH
InChI:InChI=1S/C5H5ClN2O.ClH/c6-4-1-3(9)2-8-5(4)7;/h1-2,9H,(H2,7,8);1H
InChI key:InChIKey=BIJOEYYAEXXOQH-UHFFFAOYSA-N
SMILES:ClC1=C(N)N=CC(O)=C1.Cl
Synonyms:
  • 3-Pyridinol, 6-amino-5-chloro-, hydrochloride (1:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.