CAS 1263378-42-2
:3-(2,5-Difluorophenoxy)azetidine
Description:
3-(2,5-Difluorophenoxy)azetidine is a chemical compound characterized by its azetidine ring structure, which is a four-membered saturated heterocyclic compound containing one nitrogen atom. The presence of the 2,5-difluorophenoxy group indicates that the azetidine is substituted with a phenoxy moiety that has two fluorine atoms located at the 2 and 5 positions of the aromatic ring. This substitution can influence the compound's physical and chemical properties, such as its solubility, reactivity, and potential biological activity. The fluorine atoms typically enhance the lipophilicity and metabolic stability of the compound. 3-(2,5-Difluorophenoxy)azetidine may be of interest in medicinal chemistry and drug development due to its unique structural features, which could contribute to specific interactions with biological targets. As with many synthetic compounds, its safety, toxicity, and environmental impact would need to be assessed through appropriate studies.
Formula:C9H9F2NO
InChI:InChI=1S/C9H9F2NO/c10-6-1-2-8(11)9(3-6)13-7-4-12-5-7/h1-3,7,12H,4-5H2
InChI key:InChIKey=XECNNPZISUHUNI-UHFFFAOYSA-N
SMILES:O(C1=C(F)C=CC(F)=C1)C2CNC2
Synonyms:- 3-(2,5-Difluorophenoxy)azetidine
- Azetidine, 3-(2,5-difluorophenoxy)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
