CAS 1263378-48-8

Piperidine, 3-(1H-imidazol-2-yl)-, hydrochloride (1:2)

Description:

Piperidine, 3-(1H-imidazol-2-yl)-, hydrochloride (1:2) is a chemical compound characterized by its piperidine and imidazole functional groups. It typically appears as a white to off-white crystalline solid and is soluble in water due to the presence of the hydrochloride salt form, which enhances its solubility compared to the free base. The compound is often studied for its potential biological activities, including its role as a pharmacological agent or in medicinal chemistry. Its structure suggests that it may exhibit properties related to neurotransmitter modulation or enzyme inhibition, making it of interest in drug development. The presence of both piperidine and imidazole rings may contribute to its ability to interact with various biological targets. As with many chemical substances, safety data should be consulted, as it may pose health risks if not handled properly. Overall, this compound represents a unique combination of heterocyclic structures that may offer diverse applications in research and industry.

Formula: C₈H₁₃N₃·2ClH

InChI: InChI=1S/C8H13N3.2ClH/c1-2-7(6-9-3-1)8-10-4-5-11-8;;/h4-5,7,9H,1-3,6H2,(H,10,11);2*1H

InChI key: InChIKey=GCUCSRLYSZQZOJ-UHFFFAOYSA-N

SMILES: C=1(NC=CN1)C2CCCNC2.Cl

Synonyms:

• Piperidine, 3-(1H-imidazol-2-yl)-, hydrochloride (1:2)