CymitQuimica logo

CAS 1263378-55-7

:

[1,2,4]Triazolo[1,5-a]pyrazine, 5,6,7,8-tetrahydro-2-methyl-, hydrochloride (1:1)

Description:
[1,2,4]Triazolo[1,5-a]pyrazine, 5,6,7,8-tetrahydro-2-methyl-, hydrochloride (1:1) is a chemical compound characterized by its unique bicyclic structure, which incorporates both triazole and pyrazine moieties. This compound typically appears as a hydrochloride salt, enhancing its solubility in aqueous environments. The presence of the tetrahydro group indicates that it has a saturated ring system, contributing to its stability and potential biological activity. The methyl group at the 2-position of the tetrahydro structure may influence its pharmacological properties, making it of interest in medicinal chemistry. Compounds of this class are often studied for their potential applications in pharmaceuticals, particularly in the development of agents with antimicrobial, anti-inflammatory, or neuroprotective effects. The CAS number 1263378-55-7 serves as a unique identifier for this substance, facilitating its recognition in chemical databases and literature. As with many nitrogen-containing heterocycles, the compound's reactivity and interactions can be influenced by the presence of functional groups and the overall electronic environment of the molecule.
Formula:C6H10N4·ClH
InChI:InChI=1S/C6H10N4.ClH/c1-5-8-6-4-7-2-3-10(6)9-5;/h7H,2-4H2,1H3;1H
InChI key:InChIKey=PDGHREKDLLUVKX-UHFFFAOYSA-N
SMILES:CC=1N=C2N(N1)CCNC2.Cl
Synonyms:
  • [1,2,4]Triazolo[1,5-a]pyrazine, 5,6,7,8-tetrahydro-2-methyl-, hydrochloride (1:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.